CAS 17788-47-5 appears in our catalog under these names: 5–Nitronaphthalene–1,4–dione, 5-Nitro-1,4-naphthoquinone, 95%, 5-Nitronaphthalene-1,4-dione 97%, 5-Nitronaphthalene-1,4-dione, 95%, 5-Nitronaphthalene-1,4-dione, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
5-nitronaphthalene-1,4-dione (CAS 17788-47-5) is a chemical compound with the molecular formula C10H5NO4 and a molecular weight of 203.15 g/mol. IUPAC name: 5-nitronaphthalene-1,4-dione. InChIKey: VSBOSAGJYNRBJN-UHFFFAOYSA-N.
| Molecular formula | C10H5NO4 |
|---|---|
| Molecular weight | 203.15 g/mol |
| IUPAC name | 5-nitronaphthalene-1,4-dione |
| InChIKey | VSBOSAGJYNRBJN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=CC2=O)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)