Products 17791-34-3
CAS 17791-34-3 is the registry number for Exo-methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylate (CAS 17791-34-3) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: methyl (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: UYMKMUZNHJKUQB-RRKCRQDMSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | methyl (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | UYMKMUZNHJKUQB-RRKCRQDMSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CC[C@H]1O2 |
Computed by PubChem (NCBI)