Products 1779121-34-4

CAS 1779121-34-4 is the registry number for 3-(Cyclopropylmethoxy)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(cyclopropylmethoxy)cyclobutane-1-carboxylic acid (CAS 1779121-34-4) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 3-(cyclopropylmethoxy)cyclobutane-1-carboxylic acid. InChIKey: YDPSMSJDPULEFH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O3
Molecular weight170.21 g/mol
IUPAC name3-(cyclopropylmethoxy)cyclobutane-1-carboxylic acid
InChIKeyYDPSMSJDPULEFH-UHFFFAOYSA-N
SMILESC1CC1COC2CC(C2)C(=O)O

Computed by PubChem (NCBI)