CAS 177944-76-2 is the registry number for 5-Bromo-6-nitro-1,3-dihydro-1,3-benzodiazol-2-one, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-6-nitro-1,3-dihydrobenzimidazol-2-one (CAS 177944-76-2) is a chemical compound with the molecular formula C7H4BrN3O3 and a molecular weight of 258.03 g/mol. IUPAC name: 5-bromo-6-nitro-1,3-dihydrobenzimidazol-2-one. InChIKey: XEYDMJKJYYGQCN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O3 |
|---|---|
| Molecular weight | 258.03 g/mol |
| IUPAC name | 5-bromo-6-nitro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | XEYDMJKJYYGQCN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])Br)NC(=O)N2 |
Computed by PubChem (NCBI)