Products 1779445-49-6

CAS 1779445-49-6 is the registry number for 2,5-Diazabicyclo[2.2.1]heptane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid (CAS 1779445-49-6) is a chemical compound with the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. IUPAC name: 2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: RHGSFHMFDIYZNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N2O2
Molecular weight142.16 g/mol
IUPAC name2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid
InChIKeyRHGSFHMFDIYZNJ-UHFFFAOYSA-N
SMILESC1C2CNC1(CN2)C(=O)O

Computed by PubChem (NCBI)