CAS 177952-38-4 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)benzonitrile, 95%, 2,4-Bis(trifluoromethyl)benzonitrile, 98%+,RG. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
2,4-bis(trifluoromethyl)benzonitrile (CAS 177952-38-4) is a chemical compound with the molecular formula C9H3F6N and a molecular weight of 239.12 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)benzonitrile. InChIKey: RQKXUWGXSNMDDS-UHFFFAOYSA-N.
| Molecular formula | C9H3F6N |
|---|---|
| Molecular weight | 239.12 g/mol |
| IUPAC name | 2,4-bis(trifluoromethyl)benzonitrile |
| InChIKey | RQKXUWGXSNMDDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C#N |
Computed by PubChem (NCBI)