Products 1779524-90-1
CAS 1779524-90-1 is the registry number for LXR agonist 1, 99.95%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
N-(2-aminoethyl)-3-[3-[3-ethyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]-N-methylbenzenesulfonamide (CAS 1779524-90-1) is a chemical compound with the molecular formula C27H26F3N3O3S and a molecular weight of 529.6 g/mol. IUPAC name: N-(2-aminoethyl)-3-[3-[3-ethyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]-N-methylbenzenesulfonamide. InChIKey: QICVCEORZDRTHG-UHFFFAOYSA-N.
| Molecular formula | C27H26F3N3O3S |
|---|---|
| Molecular weight | 529.6 g/mol |
| IUPAC name | N-(2-aminoethyl)-3-[3-[3-ethyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]-N-methylbenzenesulfonamide |
| InChIKey | QICVCEORZDRTHG-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C2C(=C1C3=CC(=CC=C3)OC4=CC(=CC=C4)S(=O)(=O)N(C)CCN)C=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)