CAS 177976-12-4 appears in our catalog under these names: Sarizotan 2HCl/ 98.83% (existing batch purity), Sarizotan (dihydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg.
1-[(2R)-3,4-dihydro-2H-chromen-2-yl]-N-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]methanamine;dihydrochloride (CAS 177976-12-4) is a chemical compound with the molecular formula C22H23Cl2FN2O and a molecular weight of 421.3 g/mol. IUPAC name: 1-[(2R)-3,4-dihydro-2H-chromen-2-yl]-N-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]methanamine;dihydrochloride. InChIKey: ANXOJXYTTDGHAJ-GHVWMZMZSA-N.
| Molecular formula | C22H23Cl2FN2O |
|---|---|
| Molecular weight | 421.3 g/mol |
| IUPAC name | 1-[(2R)-3,4-dihydro-2H-chromen-2-yl]-N-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]methanamine;dihydrochloride |
| InChIKey | ANXOJXYTTDGHAJ-GHVWMZMZSA-N |
| SMILES | C1CC2=CC=CC=C2O[C@H]1CNCC3=CC(=CN=C3)C4=CC=C(C=C4)F.Cl.Cl |
Computed by PubChem (NCBI)