CAS 1779796-27-8 appears in our catalog under these names: LY2365109 hydrochloride/ 99.47% (existing batch purity), LY2365109 (hydrochloride), LY2365109 hydrochloride, LY2365109 (hydrochloride), ≥98%(HPLC), ≥98%(HPLC), LY2365109 (hydrochloride), 98.69%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
2-[2-[4-(1,3-benzodioxol-5-yl)-2-tert-butylphenoxy]ethyl-methylamino]acetic acid;hydrochloride (CAS 1779796-27-8) is a chemical compound with the molecular formula C22H28ClNO5 and a molecular weight of 421.9 g/mol. IUPAC name: 2-[2-[4-(1,3-benzodioxol-5-yl)-2-tert-butylphenoxy]ethyl-methylamino]acetic acid;hydrochloride. InChIKey: ZQVOAGQZHDAFRM-UHFFFAOYSA-N.
| Molecular formula | C22H28ClNO5 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 2-[2-[4-(1,3-benzodioxol-5-yl)-2-tert-butylphenoxy]ethyl-methylamino]acetic acid;hydrochloride |
| InChIKey | ZQVOAGQZHDAFRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C2=CC3=C(C=C2)OCO3)OCCN(C)CC(=O)O.Cl |
Computed by PubChem (NCBI)