Products 17798-15-1
CAS 17798-15-1 is the registry number for N-(2-Chloro-1-phenylethyl)-4-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-(2-chloro-1-phenylethyl)-4-methylbenzenesulfonamide (CAS 17798-15-1) is a chemical compound with the molecular formula C15H16ClNO2S and a molecular weight of 309.8 g/mol. IUPAC name: N-(2-chloro-1-phenylethyl)-4-methylbenzenesulfonamide. InChIKey: JCIHMVMXJDYETN-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2S |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | N-(2-chloro-1-phenylethyl)-4-methylbenzenesulfonamide |
| InChIKey | JCIHMVMXJDYETN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)