CAS 1780-37-6 is the registry number for 5-(Bromomethyl)-2,4,6-trichloropyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5-(bromomethyl)-2,4,6-trichloropyrimidine (CAS 1780-37-6) is a chemical compound with the molecular formula C5H2BrCl3N2 and a molecular weight of 276.3 g/mol. IUPAC name: 5-(bromomethyl)-2,4,6-trichloropyrimidine. InChIKey: MTJKSXNANQVPIO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrCl3N2 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 5-(bromomethyl)-2,4,6-trichloropyrimidine |
| InChIKey | MTJKSXNANQVPIO-UHFFFAOYSA-N |
| SMILES | C(C1=C(N=C(N=C1Cl)Cl)Cl)Br |
Computed by PubChem (NCBI)