CAS 1780-40-1 appears in our catalog under these names: 2,4,5,6-Tetrachloropyrimidine, >98.0%(GC), 2,4,5,6-Tetrachloropyrimidine 96%, 2,4,5,6-Tetrachloropyrimidine, 96%. Offered by: TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
2,4,5,6-tetrachloropyrimidine (CAS 1780-40-1) is a chemical compound with the molecular formula C4Cl4N2 and a molecular weight of 217.9 g/mol. IUPAC name: 2,4,5,6-tetrachloropyrimidine. InChIKey: GVBHCMNXRKOJRH-UHFFFAOYSA-N.
| Molecular formula | C4Cl4N2 |
|---|---|
| Molecular weight | 217.9 g/mol |
| IUPAC name | 2,4,5,6-tetrachloropyrimidine |
| InChIKey | GVBHCMNXRKOJRH-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)