Products 1780230-91-2

CAS 1780230-91-2 is the registry number for 3,3-Difluoro-5,5-dimethylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid (CAS 1780230-91-2) is a chemical compound with the molecular formula C9H14F2O2 and a molecular weight of 192.20 g/mol. IUPAC name: 3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid. InChIKey: KMBOEOHYXSVCJI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14F2O2
Molecular weight192.20 g/mol
IUPAC name3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid
InChIKeyKMBOEOHYXSVCJI-UHFFFAOYSA-N
SMILESCC1(CC(CC(C1)(F)F)C(=O)O)C

Computed by PubChem (NCBI)