CAS 1780230-91-2 is the registry number for 3,3-Difluoro-5,5-dimethylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid (CAS 1780230-91-2) is a chemical compound with the molecular formula C9H14F2O2 and a molecular weight of 192.20 g/mol. IUPAC name: 3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid. InChIKey: KMBOEOHYXSVCJI-UHFFFAOYSA-N.
| Molecular formula | C9H14F2O2 |
|---|---|
| Molecular weight | 192.20 g/mol |
| IUPAC name | 3,3-difluoro-5,5-dimethylcyclohexane-1-carboxylic acid |
| InChIKey | KMBOEOHYXSVCJI-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(C1)(F)F)C(=O)O)C |
Computed by PubChem (NCBI)