Products 1780277-74-8
CAS 1780277-74-8 is the registry number for 4-Fluorobicyclo(4.2.0)octa-1,3,5-triene-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid (CAS 1780277-74-8) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid. InChIKey: FECFIGBNSKXRJS-UHFFFAOYSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid |
| InChIKey | FECFIGBNSKXRJS-UHFFFAOYSA-N |
| SMILES | C1C(C2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)