Products 1780647-42-8

CAS 1780647-42-8 is the registry number for 4,4-Difluoro-3-(3-fluorophenyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4,4-difluoro-3-(3-fluorophenyl)butanoic acid (CAS 1780647-42-8) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 4,4-difluoro-3-(3-fluorophenyl)butanoic acid. InChIKey: NKGYAJUMBGKQGE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3O2
Molecular weight218.17 g/mol
IUPAC name4,4-difluoro-3-(3-fluorophenyl)butanoic acid
InChIKeyNKGYAJUMBGKQGE-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)C(CC(=O)O)C(F)F

Computed by PubChem (NCBI)