Products 1780685-02-0

CAS 1780685-02-0 appears in our catalog under these names: 2,2-Difluorobutane-1-sulfonyl chloride, 95%, 2,2-Difluorobutane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,2-difluorobutane-1-sulfonyl chloride (CAS 1780685-02-0) is a chemical compound with the molecular formula C4H7ClF2O2S and a molecular weight of 192.61 g/mol. IUPAC name: 2,2-difluorobutane-1-sulfonyl chloride. InChIKey: OVDYWQHRHYSPNK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClF2O2S
Molecular weight192.61 g/mol
IUPAC name2,2-difluorobutane-1-sulfonyl chloride
InChIKeyOVDYWQHRHYSPNK-UHFFFAOYSA-N
SMILESCCC(CS(=O)(=O)Cl)(F)F

Computed by PubChem (NCBI)