Products 1780706-69-5
CAS 1780706-69-5 is the registry number for 2-(3-(Trifluoromethyl)-1H-1,2,4-triazol-1-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]propanoic acid (CAS 1780706-69-5) is a chemical compound with the molecular formula C6H6F3N3O2 and a molecular weight of 209.13 g/mol. IUPAC name: 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]propanoic acid. InChIKey: ZWRQRIJYPUJJJU-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3O2 |
|---|---|
| Molecular weight | 209.13 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]propanoic acid |
| InChIKey | ZWRQRIJYPUJJJU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C=NC(=N1)C(F)(F)F |
Computed by PubChem (NCBI)