Products 1780909-44-5
CAS 1780909-44-5 is the registry number for tert-butyl 3-(2-amino-1,1-difluoroethyl)azetidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 3-(2-amino-1,1-difluoroethyl)azetidine-1-carboxylate (CAS 1780909-44-5) is a chemical compound with the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl 3-(2-amino-1,1-difluoroethyl)azetidine-1-carboxylate. InChIKey: LJCIOLSYYHFHTJ-UHFFFAOYSA-N.
| Molecular formula | C10H18F2N2O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl 3-(2-amino-1,1-difluoroethyl)azetidine-1-carboxylate |
| InChIKey | LJCIOLSYYHFHTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(CN)(F)F |
Computed by PubChem (NCBI)