Products 1780909-97-8
CAS 1780909-97-8 is the registry number for Methyl 3-amino-6-fluoro-2-hydroxybenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 3-amino-6-fluoro-2-hydroxybenzoate (CAS 1780909-97-8) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: methyl 3-amino-6-fluoro-2-hydroxybenzoate. InChIKey: FALCMJIZDKICGV-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | methyl 3-amino-6-fluoro-2-hydroxybenzoate |
| InChIKey | FALCMJIZDKICGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1O)N)F |
Computed by PubChem (NCBI)