CAS 1781039-51-7 is the registry number for 3,3-Difluoro-4-methylpentane-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,3-difluoro-4-methylpentane-1-sulfonyl chloride (CAS 1781039-51-7) is a chemical compound with the molecular formula C6H11ClF2O2S and a molecular weight of 220.67 g/mol. IUPAC name: 3,3-difluoro-4-methylpentane-1-sulfonyl chloride. InChIKey: ARJHZLNQWPYCGA-UHFFFAOYSA-N.
| Molecular formula | C6H11ClF2O2S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 3,3-difluoro-4-methylpentane-1-sulfonyl chloride |
| InChIKey | ARJHZLNQWPYCGA-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCS(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)