Products 1781189-10-3

CAS 1781189-10-3 is the registry number for 9,9-Difluoro-3-azaspiro[5.5]undecane hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

9,9-difluoro-3-azaspiro[5.5]undecane;hydrochloride (CAS 1781189-10-3) is a chemical compound with the molecular formula C10H18ClF2N and a molecular weight of 225.70 g/mol. IUPAC name: 9,9-difluoro-3-azaspiro[5.5]undecane;hydrochloride. InChIKey: DCAOUVHDJYDKTD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClF2N
Molecular weight225.70 g/mol
IUPAC name9,9-difluoro-3-azaspiro[5.5]undecane;hydrochloride
InChIKeyDCAOUVHDJYDKTD-UHFFFAOYSA-N
SMILESC1CC(CCC12CCNCC2)(F)F.Cl

Computed by PubChem (NCBI)