Products 1781448-62-1

CAS 1781448-62-1 is the registry number for 3,3-Difluoro-2,2-dimethylpropane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3-difluoro-2,2-dimethylpropane-1-sulfonyl chloride (CAS 1781448-62-1) is a chemical compound with the molecular formula C5H9ClF2O2S and a molecular weight of 206.64 g/mol. IUPAC name: 3,3-difluoro-2,2-dimethylpropane-1-sulfonyl chloride. InChIKey: XZWPNUGBFGDLOG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClF2O2S
Molecular weight206.64 g/mol
IUPAC name3,3-difluoro-2,2-dimethylpropane-1-sulfonyl chloride
InChIKeyXZWPNUGBFGDLOG-UHFFFAOYSA-N
SMILESCC(C)(CS(=O)(=O)Cl)C(F)F

Computed by PubChem (NCBI)