Products 1781476-00-3

CAS 1781476-00-3 is the registry number for 2-Cyclopropyl-2-(oxolan-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-cyclopropyl-2-(oxolan-2-yl)acetic acid (CAS 1781476-00-3) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 2-cyclopropyl-2-(oxolan-2-yl)acetic acid. InChIKey: RHXDYUCYQPARCE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O3
Molecular weight170.21 g/mol
IUPAC name2-cyclopropyl-2-(oxolan-2-yl)acetic acid
InChIKeyRHXDYUCYQPARCE-UHFFFAOYSA-N
SMILESC1CC(OC1)C(C2CC2)C(=O)O

Computed by PubChem (NCBI)