CAS 1781505-77-8 is the registry number for 5-Bromo-2-(difluoromethyl)-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(difluoromethyl)-1H-indole (CAS 1781505-77-8) is a chemical compound with the molecular formula C9H6BrF2N and a molecular weight of 246.05 g/mol. IUPAC name: 5-bromo-2-(difluoromethyl)-1H-indole. InChIKey: UNMSZECOCCPVBD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethyl)-1H-indole |
| InChIKey | UNMSZECOCCPVBD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(N2)C(F)F |
Computed by PubChem (NCBI)