Products 1781540-74-6
CAS 1781540-74-6 is the registry number for tert-Butyl 3,5-difluoro-4-hydroxypiperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 3,5-difluoro-4-hydroxypiperidine-1-carboxylate (CAS 1781540-74-6) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,5-difluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: PZPDVALOSYWDOT-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,5-difluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | PZPDVALOSYWDOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C(C1)F)O)F |
Computed by PubChem (NCBI)