Products 1781638-68-3

CAS 1781638-68-3 is the registry number for 3-(Dimethylamino)-2,2-difluoropropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(dimethylamino)-2,2-difluoropropanoic acid (CAS 1781638-68-3) is a chemical compound with the molecular formula C5H9F2NO2 and a molecular weight of 153.13 g/mol. IUPAC name: 3-(dimethylamino)-2,2-difluoropropanoic acid. InChIKey: YKQFAFDNQMKKST-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9F2NO2
Molecular weight153.13 g/mol
IUPAC name3-(dimethylamino)-2,2-difluoropropanoic acid
InChIKeyYKQFAFDNQMKKST-UHFFFAOYSA-N
SMILESCN(C)CC(C(=O)O)(F)F

Computed by PubChem (NCBI)