Products 1781710-00-6
CAS 1781710-00-6 is the registry number for 7-Cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid (CAS 1781710-00-6) is a chemical compound with the molecular formula C8H5NO4S and a molecular weight of 211.20 g/mol. IUPAC name: 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid. InChIKey: LXOSBJWNIGZWKM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid |
| InChIKey | LXOSBJWNIGZWKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(SC(=C2O1)C#N)C(=O)O |
Computed by PubChem (NCBI)