CAS 1781750-72-8 appears in our catalog under these names: CYM 50358 hydrochloride (1314212-39-9 free base), CYM50358 HCl, ≥97%(HPLC), ≥97%(HPLC), CYM50358 (hydrochloride). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-(aminomethyl)-2,6-dimethylphenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide;hydrochloride (CAS 1781750-72-8) is a chemical compound with the molecular formula C20H19Cl3N2O2 and a molecular weight of 425.7 g/mol. IUPAC name: N-[4-(aminomethyl)-2,6-dimethylphenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide;hydrochloride. InChIKey: OFDSTJOMVDAKCS-UHFFFAOYSA-N.
| Molecular formula | C20H19Cl3N2O2 |
|---|---|
| Molecular weight | 425.7 g/mol |
| IUPAC name | N-[4-(aminomethyl)-2,6-dimethylphenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide;hydrochloride |
| InChIKey | OFDSTJOMVDAKCS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C2=CC=C(O2)C3=C(C=CC(=C3)Cl)Cl)C)CN.Cl |
Computed by PubChem (NCBI)