CAS 1781835-02-6 appears in our catalog under these names: WAY 316606 Hydrochloride, WAY 316606 hydrochloride, 5-(Phenylsulfonyl)-N-(piperidin-4-yl)-2-(trifluoromethyl)benzenesulfonamide hydrochloride, WAY 316606 (hydrochloride), 98.04%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 50mg, 25mg, 100mg, 5mg, 10 mg, 5 mg.
5-(benzenesulfonyl)-N-piperidin-4-yl-2-(trifluoromethyl)benzenesulfonamide;hydrochloride (CAS 1781835-02-6) is a chemical compound with the molecular formula C18H20ClF3N2O4S2 and a molecular weight of 484.9 g/mol. IUPAC name: 5-(benzenesulfonyl)-N-piperidin-4-yl-2-(trifluoromethyl)benzenesulfonamide;hydrochloride. InChIKey: YLOYHLUHXQJNGO-UHFFFAOYSA-N.
| Molecular formula | C18H20ClF3N2O4S2 |
|---|---|
| Molecular weight | 484.9 g/mol |
| IUPAC name | 5-(benzenesulfonyl)-N-piperidin-4-yl-2-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| InChIKey | YLOYHLUHXQJNGO-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NS(=O)(=O)C2=C(C=CC(=C2)S(=O)(=O)C3=CC=CC=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)