CAS 1781841-60-8 is the registry number for N-Methyldiethanolamine-13C,d3 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
2-[2-hydroxyethyl(trideuterio(113C)methyl)amino]ethanol;hydrochloride (CAS 1781841-60-8) is a chemical compound with the molecular formula C5H14ClNO2 and a molecular weight of 159.63 g/mol. IUPAC name: 2-[2-hydroxyethyl(trideuterio(113C)methyl)amino]ethanol;hydrochloride. InChIKey: CMPOVQUVPYXEBN-SPZGMPHYSA-N.
| Molecular formula | C5H14ClNO2 |
|---|---|
| Molecular weight | 159.63 g/mol |
| IUPAC name | 2-[2-hydroxyethyl(trideuterio(113C)methyl)amino]ethanol;hydrochloride |
| InChIKey | CMPOVQUVPYXEBN-SPZGMPHYSA-N |
| SMILES | [2H][13C]([2H])([2H])N(CCO)CCO.Cl |
Computed by PubChem (NCBI)