CAS 1781859-25-3 appears in our catalog under these names: 5-Chloro-6-fluorobenzofuran-2-carboxylic acid, 95%, 5–Chloro–6–fluoro–1–benzofuran–2–carboxylic acid, 5-Chloro-6-fluoro-1-benzofuran-2-carboxylic acid 95%, 5-Chloro-6-fluoro-1-benzofuran-2-carboxylic acid, 95%, 95%, 5-Chloro-6-fluoro-1-benzofuran-2-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 25mg, 50mg.
5-chloro-6-fluoro-1-benzofuran-2-carboxylic acid (CAS 1781859-25-3) is a chemical compound with the molecular formula C9H4ClFO3 and a molecular weight of 214.58 g/mol. IUPAC name: 5-chloro-6-fluoro-1-benzofuran-2-carboxylic acid. InChIKey: SQMUCQPNWWFEGN-UHFFFAOYSA-N.
| Molecular formula | C9H4ClFO3 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 5-chloro-6-fluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | SQMUCQPNWWFEGN-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(OC2=CC(=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)