CAS 1781866-93-0 is the registry number for 6-Bromo-4-chloro-2,3-dihydro-1H-indene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-4-chloro-2,3-dihydro-1H-indene (CAS 1781866-93-0) is a chemical compound with the molecular formula C9H8BrCl and a molecular weight of 231.51 g/mol. IUPAC name: 6-bromo-4-chloro-2,3-dihydro-1H-indene. InChIKey: YODURFYCCBRNNV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrCl |
|---|---|
| Molecular weight | 231.51 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,3-dihydro-1H-indene |
| InChIKey | YODURFYCCBRNNV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)