CAS 1781890-36-5 appears in our catalog under these names: 3-Amino-5-bromo-1-methyl-1h-pyrazole-4-carboxylic acid, 95%, 3-Amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylic acid, 98%, 98%, 3-Amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-amino-5-bromo-1-methylpyrazole-4-carboxylic acid (CAS 1781890-36-5) is a chemical compound with the molecular formula C5H6BrN3O2 and a molecular weight of 220.02 g/mol. IUPAC name: 3-amino-5-bromo-1-methylpyrazole-4-carboxylic acid. InChIKey: YQRDSIXXUXQBBW-UHFFFAOYSA-N.
| Molecular formula | C5H6BrN3O2 |
|---|---|
| Molecular weight | 220.02 g/mol |
| IUPAC name | 3-amino-5-bromo-1-methylpyrazole-4-carboxylic acid |
| InChIKey | YQRDSIXXUXQBBW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)N)C(=O)O)Br |
Computed by PubChem (NCBI)