Products 1781950-08-0
CAS 1781950-08-0 is the registry number for 1-Methyl-4-(propan-2-yl)-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-4-propan-2-ylpyrazole-5-carboxylic acid (CAS 1781950-08-0) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 1-methyl-4-propan-2-ylpyrazole-5-carboxylic acid. InChIKey: RGVYCGYGYFYFNT-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 1-methyl-4-propan-2-ylpyrazole-5-carboxylic acid |
| InChIKey | RGVYCGYGYFYFNT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(N=C1)C)C(=O)O |
Computed by PubChem (NCBI)