CAS 1782044-60-3 appears in our catalog under these names: 5–IAI (hydrochloride), 2-Amino-5-iodoindan hydrochloride, 5-IAI (hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 1g, 5 mg, 10 mg, 25 mg, 50 mg.
5-iodo-2,3-dihydro-1H-inden-2-amine;hydrochloride (CAS 1782044-60-3) is a chemical compound with the molecular formula C9H11ClIN and a molecular weight of 295.55 g/mol. IUPAC name: 5-iodo-2,3-dihydro-1H-inden-2-amine;hydrochloride. InChIKey: KXPCULLKBZKNFC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClIN |
|---|---|
| Molecular weight | 295.55 g/mol |
| IUPAC name | 5-iodo-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| InChIKey | KXPCULLKBZKNFC-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)I)N.Cl |
Computed by PubChem (NCBI)