CAS 1782267-00-8 appears in our catalog under these names: 2',3'-Dihydrospiro(cyclopropane-1,4'(1'H)-isoquinolin)-1'-one, 2',3'-Dihydro-1'H-spiro(cyclopropane-1,4'-isoquinolin)-1'-one, 98+%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 1g, 0,5g, 50mg.
Spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CAS 1782267-00-8) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one. InChIKey: GEYULTDGKVFWAO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| InChIKey | GEYULTDGKVFWAO-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)