Products 1782344-83-5

CAS 1782344-83-5 is the registry number for 1-Bromo-3-chloro-2,4-dimethylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-bromo-3-chloro-2,4-dimethylbenzene (CAS 1782344-83-5) is a chemical compound with the molecular formula C8H8BrCl and a molecular weight of 219.50 g/mol. IUPAC name: 1-bromo-3-chloro-2,4-dimethylbenzene. InChIKey: IPNHMWIEZQSACE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrCl
Molecular weight219.50 g/mol
IUPAC name1-bromo-3-chloro-2,4-dimethylbenzene
InChIKeyIPNHMWIEZQSACE-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)Br)C)Cl

Computed by PubChem (NCBI)