Products 1782510-46-6

CAS 1782510-46-6 is the registry number for 5-Bromo-4-methylisoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-4-methyl-1,2-oxazole-3-carboxylic acid (CAS 1782510-46-6) is a chemical compound with the molecular formula C5H4BrNO3 and a molecular weight of 205.99 g/mol. IUPAC name: 5-bromo-4-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: WMEBBWLQFUSNJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrNO3
Molecular weight205.99 g/mol
IUPAC name5-bromo-4-methyl-1,2-oxazole-3-carboxylic acid
InChIKeyWMEBBWLQFUSNJQ-UHFFFAOYSA-N
SMILESCC1=C(ON=C1C(=O)O)Br

Computed by PubChem (NCBI)