CAS 1782541-77-8 is the registry number for 5-(Difluoromethyl)isoindoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(difluoromethyl)-2,3-dihydro-1H-isoindole (CAS 1782541-77-8) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: 5-(difluoromethyl)-2,3-dihydro-1H-isoindole. InChIKey: ATEDVYHPRRWWSJ-UHFFFAOYSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | 5-(difluoromethyl)-2,3-dihydro-1H-isoindole |
| InChIKey | ATEDVYHPRRWWSJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)C(F)F |
Computed by PubChem (NCBI)