Products 1782836-42-3

CAS 1782836-42-3 appears in our catalog under these names: 5,5-Difluoro-2-(methoxycarbonyl)pentanoic acid, 98%, 5,5-difluoro-2-methoxycarbonyl-pentanoic acid, 97%, 97%, 5,5-difluoro-2-methoxycarbonyl-pentanoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

5,5-difluoro-2-methoxycarbonylpentanoic acid (CAS 1782836-42-3) is a chemical compound with the molecular formula C7H10F2O4 and a molecular weight of 196.15 g/mol. IUPAC name: 5,5-difluoro-2-methoxycarbonylpentanoic acid. InChIKey: DUZHRAQKBQRKMX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O4
Molecular weight196.15 g/mol
IUPAC name5,5-difluoro-2-methoxycarbonylpentanoic acid
InChIKeyDUZHRAQKBQRKMX-UHFFFAOYSA-N
SMILESCOC(=O)C(CCC(F)F)C(=O)O

Computed by PubChem (NCBI)