CAS 1782897-29-3 is the registry number for 1-Benzyl-4-bromo-5-chloropyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
1-benzyl-4-bromo-5-chloropyrazole (CAS 1782897-29-3) is a chemical compound with the molecular formula C10H8BrClN2 and a molecular weight of 271.54 g/mol. IUPAC name: 1-benzyl-4-bromo-5-chloropyrazole. InChIKey: HVMKYQPVIRRNQR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2 |
|---|---|
| Molecular weight | 271.54 g/mol |
| IUPAC name | 1-benzyl-4-bromo-5-chloropyrazole |
| InChIKey | HVMKYQPVIRRNQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(C=N2)Br)Cl |
Computed by PubChem (NCBI)