CAS 178310-99-1 is the registry number for (4,4-Difluorocyclohexyl)methyl 4-methylbenzenesulfonate, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 250mg.
(4,4-difluorocyclohexyl)methyl 4-methylbenzenesulfonate (CAS 178310-99-1) is a chemical compound with the molecular formula C14H18F2O3S and a molecular weight of 304.35 g/mol. IUPAC name: (4,4-difluorocyclohexyl)methyl 4-methylbenzenesulfonate. InChIKey: OCWUKOKBIIRNFC-UHFFFAOYSA-N.
| Molecular formula | C14H18F2O3S |
|---|---|
| Molecular weight | 304.35 g/mol |
| IUPAC name | (4,4-difluorocyclohexyl)methyl 4-methylbenzenesulfonate |
| InChIKey | OCWUKOKBIIRNFC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCC(CC2)(F)F |
Computed by PubChem (NCBI)