CAS 178312-58-8 appears in our catalog under these names: tert-Butyl 4-(azetidin-3-yl)piperazine-1-carboxylate hydrochloride, 95%, tert-Butyl 4-(3-azetidinyl)-1-piperazinecarboxylate hydrochloride, 98%, 98%, tert-Butyl 4-(azetidin-3-yl)piperazine-1-carboxylate hydrochloride, 97.0%, tert-Butyl 4-(azetidin-3-yl)piperazine-1-carboxylate hydrochloride, 97%, tert-butyl 4-(azetidin-3-yl)piperazine-1-carboxylate HCl, 98%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g, 50g, 1 g.
Tert-butyl 4-(azetidin-3-yl)piperazine-1-carboxylate;hydrochloride (CAS 178312-58-8) is a chemical compound with the molecular formula C12H24ClN3O2 and a molecular weight of 277.79 g/mol. IUPAC name: tert-butyl 4-(azetidin-3-yl)piperazine-1-carboxylate;hydrochloride. InChIKey: GYWVYUMNHDRQEC-UHFFFAOYSA-N.
| Molecular formula | C12H24ClN3O2 |
|---|---|
| Molecular weight | 277.79 g/mol |
| IUPAC name | tert-butyl 4-(azetidin-3-yl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | GYWVYUMNHDRQEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2CNC2.Cl |
Computed by PubChem (NCBI)