Products 178316-78-4

CAS 178316-78-4 is the registry number for 3-Oxo-2,3-dihydroisoxazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-oxo-1,2-oxazole-4-carboxylic acid (CAS 178316-78-4) is a chemical compound with the molecular formula C4H3NO4 and a molecular weight of 129.07 g/mol. IUPAC name: 3-oxo-1,2-oxazole-4-carboxylic acid. InChIKey: JLPHBZYAQYOJND-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3NO4
Molecular weight129.07 g/mol
IUPAC name3-oxo-1,2-oxazole-4-carboxylic acid
InChIKeyJLPHBZYAQYOJND-UHFFFAOYSA-N
SMILESC1=C(C(=O)NO1)C(=O)O

Computed by PubChem (NCBI)