Products 1783571-05-0

CAS 1783571-05-0 is the registry number for 4-Chloro-3-ethylisoxazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-chloro-3-ethyl-1,2-oxazole-5-carboxylic acid (CAS 1783571-05-0) is a chemical compound with the molecular formula C6H6ClNO3 and a molecular weight of 175.57 g/mol. IUPAC name: 4-chloro-3-ethyl-1,2-oxazole-5-carboxylic acid. InChIKey: CAIABEUZJFSOQV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO3
Molecular weight175.57 g/mol
IUPAC name4-chloro-3-ethyl-1,2-oxazole-5-carboxylic acid
InChIKeyCAIABEUZJFSOQV-UHFFFAOYSA-N
SMILESCCC1=NOC(=C1Cl)C(=O)O

Computed by PubChem (NCBI)