Products 1783607-43-1

CAS 1783607-43-1 is the registry number for 2-Bromo-3-chloro-5-methylpyrazine 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-bromo-3-chloro-5-methylpyrazine (CAS 1783607-43-1) is a chemical compound with the molecular formula C5H4BrClN2 and a molecular weight of 207.45 g/mol. IUPAC name: 2-bromo-3-chloro-5-methylpyrazine. InChIKey: GITYNTCJEZVXBP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrClN2
Molecular weight207.45 g/mol
IUPAC name2-bromo-3-chloro-5-methylpyrazine
InChIKeyGITYNTCJEZVXBP-UHFFFAOYSA-N
SMILESCC1=CN=C(C(=N1)Cl)Br

Computed by PubChem (NCBI)