Products 1783954-35-7

CAS 1783954-35-7 is the registry number for 2-(Difluoromethyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(difluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1783954-35-7) is a chemical compound with the molecular formula C5H3F2NO2S and a molecular weight of 179.15 g/mol. IUPAC name: 2-(difluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: IKIWPZTVHMTSNA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3F2NO2S
Molecular weight179.15 g/mol
IUPAC name2-(difluoromethyl)-1,3-thiazole-5-carboxylic acid
InChIKeyIKIWPZTVHMTSNA-UHFFFAOYSA-N
SMILESC1=C(SC(=N1)C(F)F)C(=O)O

Computed by PubChem (NCBI)