CAS 1784-05-0 appears in our catalog under these names: Ac-arg-ome hydrochloride, 95%, N-Acetyl-L-arginine Methyl Ester Hydrochloride, (S)-Methyl 2-acetamido-5-guanidinopentanoate hydrochloride, 97%, Ac–Arg–OMe · HCl, N-alpha-Acetyl-L-arginine methyl ester hydrochloride. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 2g.
Methyl (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoate;hydrochloride (CAS 1784-05-0) is a chemical compound with the molecular formula C9H19ClN4O3 and a molecular weight of 266.72 g/mol. IUPAC name: methyl (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoate;hydrochloride. InChIKey: FIUSXBMWQFBXLZ-FJXQXJEOSA-N.
| Molecular formula | C9H19ClN4O3 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | methyl (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoate;hydrochloride |
| InChIKey | FIUSXBMWQFBXLZ-FJXQXJEOSA-N |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)