Products 1784024-91-4
CAS 1784024-91-4 is the registry number for 2-[(3-bromopyridin-2-yl)amino]acetic acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(3-bromo-2-pyridinyl)amino]acetic acid (CAS 1784024-91-4) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 2-[(3-bromo-2-pyridinyl)amino]acetic acid. InChIKey: ZKRYSEOIHFYPPA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 2-[(3-bromo-2-pyridinyl)amino]acetic acid |
| InChIKey | ZKRYSEOIHFYPPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NCC(=O)O)Br |
Computed by PubChem (NCBI)