CAS 1784053-27-5 is the registry number for 3-(Diethylamino)-2,2-dimethyl-1-propanol 4-Nitrobenzoate Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 1g.
[3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate;hydrochloride (CAS 1784053-27-5) is a chemical compound with the molecular formula C16H25ClN2O4 and a molecular weight of 344.8 g/mol. IUPAC name: [3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate;hydrochloride. InChIKey: FEIWWHYGEWMWRP-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2O4 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | [3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate;hydrochloride |
| InChIKey | FEIWWHYGEWMWRP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)